C18H14FN4O- — CID 142196802
(Z)-[3-(2-amino-6-methylpyrimidin-4-yl)-6-iminocyclohexa-2,4-dien-1-ylidene]-(4-fluorophenyl)methanolate (PubChem CID 142196802) has the molecular formula C18H14FN4O- and a molecular weight of 321.34 g/mol. Its IUPAC name is (Z)-[3-(2-amino-6-methylpyrimidin-4-yl)-6-iminocyclohexa-2,4-dien-1-ylidene]-(4-fluorophenyl)methanolate.
| Compound Name | (Z)-[3-(2-amino-6-methylpyrimidin-4-yl)-6-iminocyclohexa-2,4-dien-1-ylidene]-(4-fluorophenyl)methanolate |
|---|---|
| PubChem CID | 142196802 |
| Molecular Formula | C18H14FN4O- |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | (Z)-[3-(2-amino-6-methylpyrimidin-4-yl)-6-iminocyclohexa-2,4-dien-1-ylidene]-(4-fluorophenyl)methanolate |
| SMILES | [H]/N=C1\C=CC(c2cc(C)nc(N)n2)=C\C1=C(\[O-])c1ccc(F)cc1 |
| InChI | InChI=1S/C18H15FN4O/c1-10-8-16(23-18(21)22-10)12-4-7-15(20)14(9-12)17(24)11-2-5-13(19)6-3-11/h2-9,20,24H,1H3,(H2,21,22,23)/p-1/b17-14-,20-15+ |
| InChIKey | ISTHPUWCWACBTQ-KIYPBSQKSA-M |
| XLogP | 2.25 |
| TPSA | 98.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|