C17H12FN4O- — CID 142196831
(Z)-[3-(2-aminopyrimidin-4-yl)-6-iminocyclohexa-2,4-dien-1-ylidene]-(3-fluorophenyl)methanolate (PubChem CID 142196831) has the molecular formula C17H12FN4O- and a molecular weight of 307.31 g/mol. Its IUPAC name is (Z)-[3-(2-aminopyrimidin-4-yl)-6-iminocyclohexa-2,4-dien-1-ylidene]-(3-fluorophenyl)methanolate.
| Compound Name | (Z)-[3-(2-aminopyrimidin-4-yl)-6-iminocyclohexa-2,4-dien-1-ylidene]-(3-fluorophenyl)methanolate |
|---|---|
| PubChem CID | 142196831 |
| Molecular Formula | C17H12FN4O- |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | (Z)-[3-(2-aminopyrimidin-4-yl)-6-iminocyclohexa-2,4-dien-1-ylidene]-(3-fluorophenyl)methanolate |
| SMILES | [H]/N=C1\C=CC(c2ccnc(N)n2)=C\C1=C(\[O-])c1cccc(F)c1 |
| InChI | InChI=1S/C17H13FN4O/c18-12-3-1-2-11(8-12)16(23)13-9-10(4-5-14(13)19)15-6-7-21-17(20)22-15/h1-9,19,23H,(H2,20,21,22)/p-1/b16-13-,19-14+ |
| InChIKey | GSWVNRAFXUHAGT-HARCQHEZSA-M |
| XLogP | 1.94 |
| TPSA | 98.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|