C24H18FN4O- — CID 142196861
(Z)-[3-[2-(benzylamino)pyrimidin-4-yl]-6-iminocyclohexa-2,4-dien-1-ylidene]-(4-fluorophenyl)methanolate (PubChem CID 142196861) has the molecular formula C24H18FN4O- and a molecular weight of 397.43 g/mol. Its IUPAC name is (Z)-[3-[2-(benzylamino)pyrimidin-4-yl]-6-iminocyclohexa-2,4-dien-1-ylidene]-(4-fluorophenyl)methanolate.
| Compound Name | (Z)-[3-[2-(benzylamino)pyrimidin-4-yl]-6-iminocyclohexa-2,4-dien-1-ylidene]-(4-fluorophenyl)methanolate |
|---|---|
| PubChem CID | 142196861 |
| Molecular Formula | C24H18FN4O- |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | (Z)-[3-[2-(benzylamino)pyrimidin-4-yl]-6-iminocyclohexa-2,4-dien-1-ylidene]-(4-fluorophenyl)methanolate |
| SMILES | [H]/N=C1\C=CC(c2ccnc(NCc3ccccc3)n2)=C\C1=C(\[O-])c1ccc(F)cc1 |
| InChI | InChI=1S/C24H19FN4O/c25-19-9-6-17(7-10-19)23(30)20-14-18(8-11-21(20)26)22-12-13-27-24(29-22)28-15-16-4-2-1-3-5-16/h1-14,26,30H,15H2,(H,27,28,29)/p-1/b23-20-,26-21+ |
| InChIKey | ZIFZGPWFGCAOCR-SVWANLHPSA-M |
| XLogP | 3.97 |
| TPSA | 84.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|