C28H24N2O4 — CID 142197494
N-(5-acetyl-2-pyridinyl)-3,5-bis(phenylmethoxy)benzamide (PubChem CID 142197494) has the molecular formula C28H24N2O4 and a molecular weight of 452.51 g/mol. Its IUPAC name is N-(5-acetyl-2-pyridinyl)-3,5-bis(phenylmethoxy)benzamide.
| Compound Name | N-(5-acetyl-2-pyridinyl)-3,5-bis(phenylmethoxy)benzamide |
|---|---|
| PubChem CID | 142197494 |
| Molecular Formula | C28H24N2O4 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | N-(5-acetyl-2-pyridinyl)-3,5-bis(phenylmethoxy)benzamide |
| SMILES | CC(=O)c1ccc(NC(=O)c2cc(OCc3ccccc3)cc(OCc3ccccc3)c2)nc1 |
| InChI | InChI=1S/C28H24N2O4/c1-20(31)23-12-13-27(29-17-23)30-28(32)24-14-25(33-18-21-8-4-2-5-9-21)16-26(15-24)34-19-22-10-6-3-7-11-22/h2-17H,18-19H2,1H3,(H,29,30,32) |
| InChIKey | XFKYKYAUULKIML-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |