C22H24N4O3S — CID 142197510
6-[1-[3-amino-5-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]phenyl]but-1-enylamino]pyridine-3-carboxylic acid (PubChem CID 142197510) has the molecular formula C22H24N4O3S and a molecular weight of 424.53 g/mol. Its IUPAC name is 6-[1-[3-amino-5-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]phenyl]but-1-enylamino]pyridine-3-carboxylic acid.
| Compound Name | 6-[1-[3-amino-5-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]phenyl]but-1-enylamino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 142197510 |
| Molecular Formula | C22H24N4O3S |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | 6-[1-[3-amino-5-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]phenyl]but-1-enylamino]pyridine-3-carboxylic acid |
| SMILES | CCC=C(Nc1ccc(C(=O)O)cn1)c1cc(N)cc(OCCc2scnc2C)c1 |
| InChI | InChI=1S/C22H24N4O3S/c1-3-4-19(26-21-6-5-15(12-24-21)22(27)28)16-9-17(23)11-18(10-16)29-8-7-20-14(2)25-13-30-20/h4-6,9-13H,3,7-8,23H2,1-2H3,(H,24,26)(H,27,28) |
| InChIKey | AATBJHGMVDZWSB-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 110.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|