C17H16N4O4S2 — CID 59735803
2-[[3-amino-5-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]benzoyl]amino]-1,3-thiazole-5-carboxylic acid (PubChem CID 59735803) has the molecular formula C17H16N4O4S2 and a molecular weight of 404.47 g/mol. Its IUPAC name is 2-[[3-amino-5-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]benzoyl]amino]-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-[[3-amino-5-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]benzoyl]amino]-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 59735803 |
| Molecular Formula | C17H16N4O4S2 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | 2-[[3-amino-5-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]benzoyl]amino]-1,3-thiazole-5-carboxylic acid |
| SMILES | Cc1ncsc1CCOc1cc(N)cc(C(=O)Nc2ncc(C(=O)O)s2)c1 |
| InChI | InChI=1S/C17H16N4O4S2/c1-9-13(26-8-20-9)2-3-25-12-5-10(4-11(18)6-12)15(22)21-17-19-7-14(27-17)16(23)24/h4-8H,2-3,18H2,1H3,(H,23,24)(H,19,21,22) |
| InChIKey | CKRPJBJRJYLVNB-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 127.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|