About methane;3-(3-methylidenepent-4-enoxy)-5-propan-2-yloxybenzaldehyde;sulfane
methane;3-(3-methylidenepent-4-enoxy)-5-propan-2-yloxybenzaldehyde;sulfane (PubChem CID 142197617) has the molecular formula C17H26O3S
and a molecular weight of 310.46 g/mol. Its IUPAC name is methane;3-(3-methylidenepent-4-enoxy)-5-propan-2-yloxybenzaldehyde;sulfane.
Molecular Properties
| Compound Name | methane;3-(3-methylidenepent-4-enoxy)-5-propan-2-yloxybenzaldehyde;sulfane |
| PubChem CID | 142197617 |
| Molecular Formula | C17H26O3S |
| Molecular Weight | 310.46 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | methane;3-(3-methylidenepent-4-enoxy)-5-propan-2-yloxybenzaldehyde;sulfane |
| SMILES | C.C=CC(=C)CCOc1cc(C=O)cc(OC(C)C)c1.S |
| InChI | InChI=1S/C16H20O3.CH4.H2S/c1-5-13(4)6-7-18-15-8-14(11-17)9-16(10-15)19-12(2)3;;/h5,8-12H,1,4,6-7H2,2-3H3;1H4;1H2 |
| InChIKey | CGVLAVOGZPYEGQ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.46 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze methane;3-(3-methylidenepent-4-enoxy)-5-propan-2-yloxybenzaldehyde;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;3-(3-methylidenepent-4-enoxy)-5-propan-2-yloxybenzaldehyde;sulfane?
The IUPAC name of methane;3-(3-methylidenepent-4-enoxy)-5-propan-2-yloxybenzaldehyde;sulfane (CID 142197617) is methane;3-(3-methylidenepent-4-enoxy)-5-propan-2-yloxybenzaldehyde;sulfane.
What is the SMILES notation for methane;3-(3-methylidenepent-4-enoxy)-5-propan-2-yloxybenzaldehyde;sulfane?
The canonical SMILES for methane;3-(3-methylidenepent-4-enoxy)-5-propan-2-yloxybenzaldehyde;sulfane is C.C=CC(=C)CCOc1cc(C=O)cc(OC(C)C)c1.S.
What is the InChIKey of methane;3-(3-methylidenepent-4-enoxy)-5-propan-2-yloxybenzaldehyde;sulfane?
The InChIKey is CGVLAVOGZPYEGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20O3.CH4.H2S/c1-5-13(4)6-7-18-15-8-14(11-17)9-16(10-15)19-12(2)3;;/h5,8-12H,1,4,6-7H2,2-3H3;1H4;1H2.
What are the key properties of methane;3-(3-methylidenepent-4-enoxy)-5-propan-2-yloxybenzaldehyde;sulfane?
methane;3-(3-methylidenepent-4-enoxy)-5-propan-2-yloxybenzaldehyde;sulfane has a molecular weight of 310.46 g/mol, XLogP of 4.55, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methane;3-(3-methylidenepent-4-enoxy)-5-propan-2-yloxybenzaldehyde;sulfane is sourced from PubChem (CID 142197617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).