C16H23ClN4O3 — CID 142197847
N'-(5-chloro-2-pyridinyl)oxamide;N,N-dimethylcyclohexanecarboxamide (PubChem CID 142197847) has the molecular formula C16H23ClN4O3 and a molecular weight of 354.84 g/mol. Its IUPAC name is N'-(5-chloro-2-pyridinyl)oxamide;N,N-dimethylcyclohexanecarboxamide.
| Compound Name | N'-(5-chloro-2-pyridinyl)oxamide;N,N-dimethylcyclohexanecarboxamide |
|---|---|
| PubChem CID | 142197847 |
| Molecular Formula | C16H23ClN4O3 |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | N'-(5-chloro-2-pyridinyl)oxamide;N,N-dimethylcyclohexanecarboxamide |
| SMILES | CN(C)C(=O)C1CCCCC1.NC(=O)C(=O)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C9H17NO.C7H6ClN3O2/c1-10(2)9(11)8-6-4-3-5-7-8;8-4-1-2-5(10-3-4)11-7(13)6(9)12/h8H,3-7H2,1-2H3;1-3H,(H2,9,12)(H,10,11,13) |
| InChIKey | IOBSAWOFAIOBEW-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|