C17H24ClN5O5S — CID 175687289
N'-(5-chloro-2-pyridinyl)-N-[4-(dimethylcarbamoyl)-2-(methanesulfonamido)cyclohexyl]oxamide (PubChem CID 175687289) has the molecular formula C17H24ClN5O5S and a molecular weight of 445.93 g/mol. Its IUPAC name is N'-(5-chloro-2-pyridinyl)-N-[4-(dimethylcarbamoyl)-2-(methanesulfonamido)cyclohexyl]oxamide.
| Compound Name | N'-(5-chloro-2-pyridinyl)-N-[4-(dimethylcarbamoyl)-2-(methanesulfonamido)cyclohexyl]oxamide |
|---|---|
| PubChem CID | 175687289 |
| Molecular Formula | C17H24ClN5O5S |
| Molecular Weight | 445.93 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | N'-(5-chloro-2-pyridinyl)-N-[4-(dimethylcarbamoyl)-2-(methanesulfonamido)cyclohexyl]oxamide |
| SMILES | CN(C)C(=O)C1CCC(NC(=O)C(=O)Nc2ccc(Cl)cn2)C(NS(C)(=O)=O)C1 |
| InChI | InChI=1S/C17H24ClN5O5S/c1-23(2)17(26)10-4-6-12(13(8-10)22-29(3,27)28)20-15(24)16(25)21-14-7-5-11(18)9-19-14/h5,7,9-10,12-13,22H,4,6,8H2,1-3H3,(H,20,24)(H,19,21,25) |
| InChIKey | NXXNHHMKZMXWCX-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 137.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.93 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|