C25H31ClN6O4S — CID 11541559
N'-(5-chloro-2-pyridinyl)-N-[(1S,2R,4S)-4-(dimethylcarbamoyl)-2-[(5-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-2-carbonyl)amino]cyclohexyl]oxamide (PubChem CID 11541559) has the molecular formula C25H31ClN6O4S and a molecular weight of 547.08 g/mol. Its IUPAC name is N'-(5-chloro-2-pyridinyl)-N-[(1S,2R,4S)-4-(dimethylcarbamoyl)-2-[(5-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-2-carbonyl)amino]cyclohexyl]oxamide.
| Compound Name | N'-(5-chloro-2-pyridinyl)-N-[(1S,2R,4S)-4-(dimethylcarbamoyl)-2-[(5-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-2-carbonyl)amino]cyclohexyl]oxamide |
|---|---|
| PubChem CID | 11541559 |
| Molecular Formula | C25H31ClN6O4S |
| Molecular Weight | 547.08 g/mol |
| Exact Mass | 546.18 |
| IUPAC Name | N'-(5-chloro-2-pyridinyl)-N-[(1S,2R,4S)-4-(dimethylcarbamoyl)-2-[(5-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-2-carbonyl)amino]cyclohexyl]oxamide |
| SMILES | CN1CCc2sc(C(=O)N[C@@H]3C[C@@H](C(=O)N(C)C)CC[C@@H]3NC(=O)C(=O)Nc3ccc(Cl)cn3)cc2C1 |
| InChI | InChI=1S/C25H31ClN6O4S/c1-31(2)25(36)14-4-6-17(28-23(34)24(35)30-21-7-5-16(26)12-27-21)18(10-14)29-22(33)20-11-15-13-32(3)9-8-19(15)37-20/h5,7,11-12,14,17-18H,4,6,8-10,13H2,1-3H3,(H,28,34)(H,29,33)(H,27,30,35)/t14-,17-,18+/m0/s1 |
| InChIKey | UCLVZZWQHPQDSF-JCGIZDLHSA-N |
| XLogP | 1.89 |
| TPSA | 123.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.08 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|