C24H29ClN6O5S — CID 25133788
ethyl (1S,3R,4S)-4-[[2-[(5-chloro-2-pyridinyl)amino]-2-oxoacetyl]amino]-3-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)amino]cyclohexane-1-carboxylate (PubChem CID 25133788) has the molecular formula C24H29ClN6O5S and a molecular weight of 549.05 g/mol. Its IUPAC name is ethyl (1S,3R,4S)-4-[[2-[(5-chloro-2-pyridinyl)amino]-2-oxoacetyl]amino]-3-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)amino]cyclohexane-1-carboxylate.
| Compound Name | ethyl (1S,3R,4S)-4-[[2-[(5-chloro-2-pyridinyl)amino]-2-oxoacetyl]amino]-3-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)amino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 25133788 |
| Molecular Formula | C24H29ClN6O5S |
| Molecular Weight | 549.05 g/mol |
| Exact Mass | 548.16 |
| IUPAC Name | ethyl (1S,3R,4S)-4-[[2-[(5-chloro-2-pyridinyl)amino]-2-oxoacetyl]amino]-3-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)amino]cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)[C@H]1CC[C@H](NC(=O)C(=O)Nc2ccc(Cl)cn2)[C@H](NC(=O)c2nc3c(s2)CN(C)CC3)C1 |
| InChI | InChI=1S/C24H29ClN6O5S/c1-3-36-24(35)13-4-6-15(27-20(32)21(33)30-19-7-5-14(25)11-26-19)17(10-13)28-22(34)23-29-16-8-9-31(2)12-18(16)37-23/h5,7,11,13,15,17H,3-4,6,8-10,12H2,1-2H3,(H,27,32)(H,28,34)(H,26,30,33)/t13-,15-,17+/m0/s1 |
| InChIKey | HWSAMLZHUTYPIC-JLJPHGGASA-N |
| XLogP | 1.76 |
| TPSA | 142.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.05 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|