C22H26ClN7O4S2 — CID 11965257
methyl (3R,4S)-4-[[2-[(5-chloro-2-pyridinyl)amino]-2-oxoethanethioyl]amino]-3-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)amino]piperidine-1-carboxylate (PubChem CID 11965257) has the molecular formula C22H26ClN7O4S2 and a molecular weight of 552.08 g/mol. Its IUPAC name is methyl (3R,4S)-4-[[2-[(5-chloro-2-pyridinyl)amino]-2-oxoethanethioyl]amino]-3-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)amino]piperidine-1-carboxylate.
| Compound Name | methyl (3R,4S)-4-[[2-[(5-chloro-2-pyridinyl)amino]-2-oxoethanethioyl]amino]-3-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 11965257 |
| Molecular Formula | C22H26ClN7O4S2 |
| Molecular Weight | 552.08 g/mol |
| Exact Mass | 551.12 |
| IUPAC Name | methyl (3R,4S)-4-[[2-[(5-chloro-2-pyridinyl)amino]-2-oxoethanethioyl]amino]-3-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)amino]piperidine-1-carboxylate |
| SMILES | COC(=O)N1CC[C@H](NC(=S)C(=O)Nc2ccc(Cl)cn2)[C@H](NC(=O)c2nc3c(s2)CN(C)CC3)C1 |
| InChI | InChI=1S/C22H26ClN7O4S2/c1-29-7-5-14-16(11-29)36-21(27-14)19(32)25-15-10-30(22(33)34-2)8-6-13(15)26-20(35)18(31)28-17-4-3-12(23)9-24-17/h3-4,9,13,15H,5-8,10-11H2,1-2H3,(H,25,32)(H,26,35)(H,24,28,31)/t13-,15+/m0/s1 |
| InChIKey | DPQUXWSFVYAEED-DZGCQCFKSA-N |
| XLogP | 1.67 |
| TPSA | 128.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.08 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|