C23H30ClN7O4S2 — CID 141224662
N-[(3R,4S)-4-[[2-[(5-chloro-2-pyridinyl)amino]-2-sulfanylacetyl]amino]-1-(2-methoxyacetyl)piperidin-3-yl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide (PubChem CID 141224662) has the molecular formula C23H30ClN7O4S2 and a molecular weight of 568.13 g/mol. Its IUPAC name is N-[(3R,4S)-4-[[2-[(5-chloro-2-pyridinyl)amino]-2-sulfanylacetyl]amino]-1-(2-methoxyacetyl)piperidin-3-yl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide.
| Compound Name | N-[(3R,4S)-4-[[2-[(5-chloro-2-pyridinyl)amino]-2-sulfanylacetyl]amino]-1-(2-methoxyacetyl)piperidin-3-yl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 141224662 |
| Molecular Formula | C23H30ClN7O4S2 |
| Molecular Weight | 568.13 g/mol |
| Exact Mass | 567.15 |
| IUPAC Name | N-[(3R,4S)-4-[[2-[(5-chloro-2-pyridinyl)amino]-2-sulfanylacetyl]amino]-1-(2-methoxyacetyl)piperidin-3-yl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide |
| SMILES | COCC(=O)N1CC[C@H](NC(=O)C(S)Nc2ccc(Cl)cn2)[C@H](NC(=O)c2nc3c(s2)CN(C)CC3)C1 |
| InChI | InChI=1S/C23H30ClN7O4S2/c1-30-7-5-15-17(11-30)37-23(28-15)21(34)27-16-10-31(19(32)12-35-2)8-6-14(16)26-20(33)22(36)29-18-4-3-13(24)9-25-18/h3-4,9,14,16,22,36H,5-8,10-12H2,1-2H3,(H,25,29)(H,26,33)(H,27,34)/t14-,16+,22?/m0/s1 |
| InChIKey | BMBGIMGCGNWQMH-KGALNUHUSA-N |
| XLogP | 1.01 |
| TPSA | 128.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.13 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|