C23H27Cl2N9O3S — CID 69012003
N'-(5-chloro-2-pyridinyl)-N-[(1S,2R,4S)-2-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)amino]-4-(1,2,4-triazol-4-yl)cyclohexyl]oxamide;hydrochloride (PubChem CID 69012003) has the molecular formula C23H27Cl2N9O3S and a molecular weight of 580.50 g/mol. Its IUPAC name is N'-(5-chloro-2-pyridinyl)-N-[(1S,2R,4S)-2-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)amino]-4-(1,2,4-triazol-4-yl)cyclohexyl]oxamide;hydrochloride.
| Compound Name | N'-(5-chloro-2-pyridinyl)-N-[(1S,2R,4S)-2-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)amino]-4-(1,2,4-triazol-4-yl)cyclohexyl]oxamide;hydrochloride |
|---|---|
| PubChem CID | 69012003 |
| Molecular Formula | C23H27Cl2N9O3S |
| Molecular Weight | 580.50 g/mol |
| Exact Mass | 579.13 |
| IUPAC Name | N'-(5-chloro-2-pyridinyl)-N-[(1S,2R,4S)-2-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)amino]-4-(1,2,4-triazol-4-yl)cyclohexyl]oxamide;hydrochloride |
| SMILES | CN1CCc2nc(C(=O)N[C@@H]3C[C@@H](n4cnnc4)CC[C@@H]3NC(=O)C(=O)Nc3ccc(Cl)cn3)sc2C1.Cl |
| InChI | InChI=1S/C23H26ClN9O3S.ClH/c1-32-7-6-16-18(10-32)37-23(30-16)22(36)29-17-8-14(33-11-26-27-12-33)3-4-15(17)28-20(34)21(35)31-19-5-2-13(24)9-25-19;/h2,5,9,11-12,14-15,17H,3-4,6-8,10H2,1H3,(H,28,34)(H,29,36)(H,25,31,35);1H/t14-,15-,17+;/m0./s1 |
| InChIKey | RCAWYTOTLXXMER-NOYXXFKXSA-N |
| XLogP | 1.84 |
| TPSA | 147.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.50 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|