C17H22FN5O4S — CID 87252195
[(3S)-3-(dimethylcarbamoyl)cyclohexyl]-[[2-[(5-fluoro-2-pyridinyl)amino]-2-oxoethanethioyl]amino]carbamic acid (PubChem CID 87252195) has the molecular formula C17H22FN5O4S and a molecular weight of 411.46 g/mol. Its IUPAC name is [(3S)-3-(dimethylcarbamoyl)cyclohexyl]-[[2-[(5-fluoro-2-pyridinyl)amino]-2-oxoethanethioyl]amino]carbamic acid.
| Compound Name | [(3S)-3-(dimethylcarbamoyl)cyclohexyl]-[[2-[(5-fluoro-2-pyridinyl)amino]-2-oxoethanethioyl]amino]carbamic acid |
|---|---|
| PubChem CID | 87252195 |
| Molecular Formula | C17H22FN5O4S |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | [(3S)-3-(dimethylcarbamoyl)cyclohexyl]-[[2-[(5-fluoro-2-pyridinyl)amino]-2-oxoethanethioyl]amino]carbamic acid |
| SMILES | CN(C)C(=O)[C@H]1CCCC(N(NC(=S)C(=O)Nc2ccc(F)cn2)C(=O)O)C1 |
| InChI | InChI=1S/C17H22FN5O4S/c1-22(2)16(25)10-4-3-5-12(8-10)23(17(26)27)21-15(28)14(24)20-13-7-6-11(18)9-19-13/h6-7,9-10,12H,3-5,8H2,1-2H3,(H,21,28)(H,26,27)(H,19,20,24)/t10-,12?/m0/s1 |
| InChIKey | GVELGJXGFHOBQU-NUHJPDEHSA-N |
| XLogP | 1.62 |
| TPSA | 114.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|