About 6a,9b-dihydro-1H-perimidine
6a,9b-dihydro-1H-perimidine (PubChem CID 142198156) has the molecular formula C11H10N2
and a molecular weight of 170.22 g/mol. Its IUPAC name is 6a,9b-dihydro-1H-perimidine.
Molecular Properties
| Compound Name | 6a,9b-dihydro-1H-perimidine |
| PubChem CID | 142198156 |
| Molecular Formula | C11H10N2 |
| Molecular Weight | 170.22 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | 6a,9b-dihydro-1H-perimidine |
| SMILES | C1=CC2C=CC=C3NC=NC(=C1)C32 |
| InChI | InChI=1S/C11H10N2/c1-3-8-4-2-6-10-11(8)9(5-1)12-7-13-10/h1-8,11H,(H,12,13) |
| InChIKey | IRKTZPMDZFWXDF-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.22 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6a,9b-dihydro-1H-perimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6a,9b-dihydro-1H-perimidine?
The IUPAC name of 6a,9b-dihydro-1H-perimidine (CID 142198156) is 6a,9b-dihydro-1H-perimidine.
What is the SMILES notation for 6a,9b-dihydro-1H-perimidine?
The canonical SMILES for 6a,9b-dihydro-1H-perimidine is C1=CC2C=CC=C3NC=NC(=C1)C32.
What is the InChIKey of 6a,9b-dihydro-1H-perimidine?
The InChIKey is IRKTZPMDZFWXDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2/c1-3-8-4-2-6-10-11(8)9(5-1)12-7-13-10/h1-8,11H,(H,12,13).
What are the key properties of 6a,9b-dihydro-1H-perimidine?
6a,9b-dihydro-1H-perimidine has a molecular weight of 170.22 g/mol, XLogP of 1.76, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6a,9b-dihydro-1H-perimidine is sourced from PubChem (CID 142198156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).