About 9b-methyl-1,6a-dihydroperimidine
9b-methyl-1,6a-dihydroperimidine (PubChem CID 163643222) has the molecular formula C12H12N2
and a molecular weight of 184.24 g/mol. Its IUPAC name is 9b-methyl-1,6a-dihydroperimidine.
Molecular Properties
| Compound Name | 9b-methyl-1,6a-dihydroperimidine |
| PubChem CID | 163643222 |
| Molecular Formula | C12H12N2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 9b-methyl-1,6a-dihydroperimidine |
| SMILES | CC12C3=CC=CC1C=CC=C2NC=N3 |
| InChI | InChI=1S/C12H12N2/c1-12-9-4-2-6-10(12)13-8-14-11(12)7-3-5-9/h2-9H,1H3,(H,13,14) |
| InChIKey | IGBPWIOREGRDRA-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9b-methyl-1,6a-dihydroperimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9b-methyl-1,6a-dihydroperimidine?
The IUPAC name of 9b-methyl-1,6a-dihydroperimidine (CID 163643222) is 9b-methyl-1,6a-dihydroperimidine.
What is the SMILES notation for 9b-methyl-1,6a-dihydroperimidine?
The canonical SMILES for 9b-methyl-1,6a-dihydroperimidine is CC12C3=CC=CC1C=CC=C2NC=N3.
What is the InChIKey of 9b-methyl-1,6a-dihydroperimidine?
The InChIKey is IGBPWIOREGRDRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2/c1-12-9-4-2-6-10(12)13-8-14-11(12)7-3-5-9/h2-9H,1H3,(H,13,14).
What are the key properties of 9b-methyl-1,6a-dihydroperimidine?
9b-methyl-1,6a-dihydroperimidine has a molecular weight of 184.24 g/mol, XLogP of 2.15, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9b-methyl-1,6a-dihydroperimidine is sourced from PubChem (CID 163643222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).