C10H16N2 — CID 171089154
N-(6,6-dimethylcyclohexa-1,3-dien-1-yl)-N'-methylmethanimidamide (PubChem CID 171089154) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is N-(6,6-dimethylcyclohexa-1,3-dien-1-yl)-N'-methylmethanimidamide.
| Compound Name | N-(6,6-dimethylcyclohexa-1,3-dien-1-yl)-N'-methylmethanimidamide |
|---|---|
| PubChem CID | 171089154 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | N-(6,6-dimethylcyclohexa-1,3-dien-1-yl)-N'-methylmethanimidamide |
| SMILES | C/N=C/NC1=CC=CCC1(C)C |
| InChI | InChI=1S/C10H16N2/c1-10(2)7-5-4-6-9(10)12-8-11-3/h4-6,8H,7H2,1-3H3,(H,11,12) |
| InChIKey | ROYXTWMRVYQNEZ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|