C13H24N2 — CID 143303386
ethane;6-ethyl-5-(2-methylbut-3-en-2-yl)-1,4-dihydropyrimidine (PubChem CID 143303386) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is ethane;6-ethyl-5-(2-methylbut-3-en-2-yl)-1,4-dihydropyrimidine.
| Compound Name | ethane;6-ethyl-5-(2-methylbut-3-en-2-yl)-1,4-dihydropyrimidine |
|---|---|
| PubChem CID | 143303386 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | ethane;6-ethyl-5-(2-methylbut-3-en-2-yl)-1,4-dihydropyrimidine |
| SMILES | C=CC(C)(C)C1=C(CC)NC=NC1.CC |
| InChI | InChI=1S/C11H18N2.C2H6/c1-5-10-9(7-12-8-13-10)11(3,4)6-2;1-2/h6,8H,2,5,7H2,1,3-4H3,(H,12,13);1-2H3 |
| InChIKey | HELFHXXBBTZEKB-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|