C27H35N3O2S — CID 142198410
1-cyclopentyl-2-[1-(4-methylphenyl)sulfanylpiperidin-4-yl]benzimidazole-5-carboxylic acid;ethane (PubChem CID 142198410) has the molecular formula C27H35N3O2S and a molecular weight of 465.66 g/mol. Its IUPAC name is 1-cyclopentyl-2-[1-(4-methylphenyl)sulfanylpiperidin-4-yl]benzimidazole-5-carboxylic acid;ethane.
| Compound Name | 1-cyclopentyl-2-[1-(4-methylphenyl)sulfanylpiperidin-4-yl]benzimidazole-5-carboxylic acid;ethane |
|---|---|
| PubChem CID | 142198410 |
| Molecular Formula | C27H35N3O2S |
| Molecular Weight | 465.66 g/mol |
| Exact Mass | 465.24 |
| IUPAC Name | 1-cyclopentyl-2-[1-(4-methylphenyl)sulfanylpiperidin-4-yl]benzimidazole-5-carboxylic acid;ethane |
| SMILES | CC.Cc1ccc(SN2CCC(c3nc4cc(C(=O)O)ccc4n3C3CCCC3)CC2)cc1 |
| InChI | InChI=1S/C25H29N3O2S.C2H6/c1-17-6-9-21(10-7-17)31-27-14-12-18(13-15-27)24-26-22-16-19(25(29)30)8-11-23(22)28(24)20-4-2-3-5-20;1-2/h6-11,16,18,20H,2-5,12-15H2,1H3,(H,29,30);1-2H3 |
| InChIKey | RDMMLKMLDUHQNY-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.66 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|