C4H7F2NO — CID 142198674
4,4-difluoropyrrolidin-2-ol (PubChem CID 142198674) has the molecular formula C4H7F2NO and a molecular weight of 123.10 g/mol. Its IUPAC name is 4,4-difluoropyrrolidin-2-ol.
| Compound Name | 4,4-difluoropyrrolidin-2-ol |
|---|---|
| PubChem CID | 142198674 |
| Molecular Formula | C4H7F2NO |
| Molecular Weight | 123.10 g/mol |
| Exact Mass | 123.05 |
| IUPAC Name | 4,4-difluoropyrrolidin-2-ol |
| SMILES | OC1CC(F)(F)CN1 |
| InChI | InChI=1S/C4H7F2NO/c5-4(6)1-3(8)7-2-4/h3,7-8H,1-2H2 |
| InChIKey | SGQAZIBWXLXPOQ-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.10 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |