C16H10Cl2N2O5 — CID 1421987
(3R)-4,6-dichloro-3-hydroxy-3-[2-(3-nitrophenyl)-2-oxoethyl]-1H-indol-2-one (PubChem CID 1421987) has the molecular formula C16H10Cl2N2O5 and a molecular weight of 381.17 g/mol. Its IUPAC name is (3R)-4,6-dichloro-3-hydroxy-3-[2-(3-nitrophenyl)-2-oxoethyl]-1H-indol-2-one.
| Compound Name | (3R)-4,6-dichloro-3-hydroxy-3-[2-(3-nitrophenyl)-2-oxoethyl]-1H-indol-2-one |
|---|---|
| PubChem CID | 1421987 |
| Molecular Formula | C16H10Cl2N2O5 |
| Molecular Weight | 381.17 g/mol |
| Exact Mass | 380.00 |
| IUPAC Name | (3R)-4,6-dichloro-3-hydroxy-3-[2-(3-nitrophenyl)-2-oxoethyl]-1H-indol-2-one |
| SMILES | O=C(C[C@]1(O)C(=O)Nc2cc(Cl)cc(Cl)c21)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H10Cl2N2O5/c17-9-5-11(18)14-12(6-9)19-15(22)16(14,23)7-13(21)8-2-1-3-10(4-8)20(24)25/h1-6,23H,7H2,(H,19,22)/t16-/m1/s1 |
| InChIKey | RTCHOVNXKJQADF-MRXNPFEDSA-N |
| XLogP | 3.31 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.17 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|