C17H12Cl2N2O6 — CID 1422583
(3R)-4,6-dichloro-3-hydroxy-3-[2-(4-methoxy-3-nitrophenyl)-2-oxoethyl]-1H-indol-2-one (PubChem CID 1422583) has the molecular formula C17H12Cl2N2O6 and a molecular weight of 411.20 g/mol. Its IUPAC name is (3R)-4,6-dichloro-3-hydroxy-3-[2-(4-methoxy-3-nitrophenyl)-2-oxoethyl]-1H-indol-2-one.
| Compound Name | (3R)-4,6-dichloro-3-hydroxy-3-[2-(4-methoxy-3-nitrophenyl)-2-oxoethyl]-1H-indol-2-one |
|---|---|
| PubChem CID | 1422583 |
| Molecular Formula | C17H12Cl2N2O6 |
| Molecular Weight | 411.20 g/mol |
| Exact Mass | 410.01 |
| IUPAC Name | (3R)-4,6-dichloro-3-hydroxy-3-[2-(4-methoxy-3-nitrophenyl)-2-oxoethyl]-1H-indol-2-one |
| SMILES | COc1ccc(C(=O)C[C@]2(O)C(=O)Nc3cc(Cl)cc(Cl)c32)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H12Cl2N2O6/c1-27-14-3-2-8(4-12(14)21(25)26)13(22)7-17(24)15-10(19)5-9(18)6-11(15)20-16(17)23/h2-6,24H,7H2,1H3,(H,20,23)/t17-/m1/s1 |
| InChIKey | AHAKZMXXXBEXPO-QGZVFWFLSA-N |
| XLogP | 3.32 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.20 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|