About CID 142199694
CID 142199694 (PubChem CID 142199694) has the molecular formula C18H28N2O4
and a molecular weight of 336.43 g/mol.
Molecular Properties
| Compound Name | CID 142199694 |
| PubChem CID | 142199694 |
| Molecular Formula | C18H28N2O4 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | — |
| SMILES | CN(C)C(=O)NC1CCC2(CC1)OOC1(O2)C2CC3CC(C2)C1C3 |
| InChI | InChI=1S/C18H28N2O4/c1-20(2)16(21)19-14-3-5-17(6-4-14)22-18(24-23-17)13-8-11-7-12(10-13)15(18)9-11/h11-15H,3-10H2,1-2H3,(H,19,21) |
| InChIKey | AUOZFVKHRXLMCX-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze CID 142199694 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 142199694?
The IUPAC name of CID 142199694 (CID 142199694) is not available.
What is the SMILES notation for CID 142199694?
The canonical SMILES for CID 142199694 is CN(C)C(=O)NC1CCC2(CC1)OOC1(O2)C2CC3CC(C2)C1C3.
What is the InChIKey of CID 142199694?
The InChIKey is AUOZFVKHRXLMCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28N2O4/c1-20(2)16(21)19-14-3-5-17(6-4-14)22-18(24-23-17)13-8-11-7-12(10-13)15(18)9-11/h11-15H,3-10H2,1-2H3,(H,19,21).
What are the key properties of CID 142199694?
CID 142199694 has a molecular weight of 336.43 g/mol, XLogP of 2.64, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 142199694 is sourced from PubChem (CID 142199694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).