About CID 159132057
CID 159132057 (PubChem CID 159132057) has the molecular formula C18H30N2O3
and a molecular weight of 322.45 g/mol.
Molecular Properties
| Compound Name | CID 159132057 |
| PubChem CID | 159132057 |
| Molecular Formula | C18H30N2O3 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | — |
| SMILES | CNC1CC(NC)CC2(C1)OOC1(O2)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C18H30N2O3/c1-19-15-8-16(20-2)10-17(9-15)21-18(23-22-17)13-4-11-3-12(6-13)7-14(18)5-11/h11-16,19-20H,3-10H2,1-2H3 |
| InChIKey | XIDPFBPECRCPNM-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 51.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze CID 159132057 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 159132057?
The IUPAC name of CID 159132057 (CID 159132057) is not available.
What is the SMILES notation for CID 159132057?
The canonical SMILES for CID 159132057 is CNC1CC(NC)CC2(C1)OOC1(O2)C2CC3CC(C2)CC1C3.
What is the InChIKey of CID 159132057?
The InChIKey is XIDPFBPECRCPNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30N2O3/c1-19-15-8-16(20-2)10-17(9-15)21-18(23-22-17)13-4-11-3-12(6-13)7-14(18)5-11/h11-16,19-20H,3-10H2,1-2H3.
What are the key properties of CID 159132057?
CID 159132057 has a molecular weight of 322.45 g/mol, XLogP of 2.17, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 159132057 is sourced from PubChem (CID 159132057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).