C31H46N2O7S — CID 10483555
CID 10483555 (PubChem CID 10483555) has the molecular formula C31H46N2O7S and a molecular weight of 590.78 g/mol.
| Compound Name | CID 10483555 |
|---|---|
| PubChem CID | 10483555 |
| Molecular Formula | C31H46N2O7S |
| Molecular Weight | 590.78 g/mol |
| Exact Mass | 590.30 |
| IUPAC Name | — |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.NC1CCC(NC(=O)CC2CCC3(CC2)OOC2(O3)C3CC4CC(C3)CC2C4)CC1 |
| InChI | InChI=1S/C24H38N2O4.C7H8O3S/c25-20-1-3-21(4-2-20)26-22(27)14-15-5-7-23(8-6-15)28-24(30-29-23)18-10-16-9-17(12-18)13-19(24)11-16;1-6-2-4-7(5-3-6)11(8,9)10/h15-21H,1-14,25H2,(H,26,27);2-5H,1H3,(H,8,9,10) |
| InChIKey | XKHYOBUVVGDIFC-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 137.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.78 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|