About CID 24989603
CID 24989603 (PubChem CID 24989603) has the molecular formula C39H57N3O10S2
and a molecular weight of 792.03 g/mol.
Molecular Properties
| Compound Name | CID 24989603 |
| PubChem CID | 24989603 |
| Molecular Formula | C39H57N3O10S2 |
| Molecular Weight | 792.03 g/mol |
| Exact Mass | 791.35 |
| IUPAC Name | — |
| SMILES | CC(C)(N)C(=O)N1CCN(CC2CCC3(CC2)OOC2(O3)C3CC4CC(C3)CC2C4)CC1.Cc1ccc(S(=O)(=O)O)cc1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C25H41N3O4.2C7H8O3S/c1-23(2,26)22(29)28-9-7-27(8-10-28)16-17-3-5-24(6-4-17)30-25(32-31-24)20-12-18-11-19(14-20)15-21(25)13-18;2*1-6-2-4-7(5-3-6)11(8,9)10/h17-21H,3-16,26H2,1-2H3;2*2-5H,1H3,(H,8,9,10) |
| InChIKey | XUAMZHZMGDWGSB-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 186.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 792.03 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze CID 24989603 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 24989603?
The IUPAC name of CID 24989603 (CID 24989603) is not available.
What is the SMILES notation for CID 24989603?
The canonical SMILES for CID 24989603 is CC(C)(N)C(=O)N1CCN(CC2CCC3(CC2)OOC2(O3)C3CC4CC(C3)CC2C4)CC1.Cc1ccc(S(=O)(=O)O)cc1.Cc1ccc(S(=O)(=O)O)cc1.
What is the InChIKey of CID 24989603?
The InChIKey is XUAMZHZMGDWGSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H41N3O4.2C7H8O3S/c1-23(2,26)22(29)28-9-7-27(8-10-28)16-17-3-5-24(6-4-17)30-25(32-31-24)20-12-18-11-19(14-20)15-21(25)13-18;2*1-6-2-4-7(5-3-6)11(8,9)10/h17-21H,3-16,26H2,1-2H3;2*2-5H,1H3,(H,8,9,10).
What are the key properties of CID 24989603?
CID 24989603 has a molecular weight of 792.03 g/mol, XLogP of 5.37, 5 rotatable bonds, 3 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 24989603 is sourced from PubChem (CID 24989603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).