C39H57N3O10S2 — CID 24989603
CID 24989603 (PubChem CID 24989603) has the molecular formula C39H57N3O10S2 and a molecular weight of 792.03 g/mol.
| Compound Name | CID 24989603 |
|---|---|
| PubChem CID | 24989603 |
| Molecular Formula | C39H57N3O10S2 |
| Molecular Weight | 792.03 g/mol |
| Exact Mass | 791.35 |
| IUPAC Name | — |
| SMILES | CC(C)(N)C(=O)N1CCN(CC2CCC3(CC2)OOC2(O3)C3CC4CC(C3)CC2C4)CC1.Cc1ccc(S(=O)(=O)O)cc1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C25H41N3O4.2C7H8O3S/c1-23(2,26)22(29)28-9-7-27(8-10-28)16-17-3-5-24(6-4-17)30-25(32-31-24)20-12-18-11-19(14-20)15-21(25)13-18;2*1-6-2-4-7(5-3-6)11(8,9)10/h17-21H,3-16,26H2,1-2H3;2*2-5H,1H3,(H,8,9,10) |
| InChIKey | XUAMZHZMGDWGSB-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 186.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.03 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|