C30H44N2O7S — CID 11757882
CID 11757882 (PubChem CID 11757882) has the molecular formula C30H44N2O7S and a molecular weight of 576.76 g/mol.
| Compound Name | CID 11757882 |
|---|---|
| PubChem CID | 11757882 |
| Molecular Formula | C30H44N2O7S |
| Molecular Weight | 576.76 g/mol |
| Exact Mass | 576.29 |
| IUPAC Name | — |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.NC1CCN(C(=O)CC2CCC3(CC2)OOC2(O3)C3CC4CC(C3)CC2C4)CC1 |
| InChI | InChI=1S/C23H36N2O4.C7H8O3S/c24-20-3-7-25(8-4-20)21(26)14-15-1-5-22(6-2-15)27-23(29-28-22)18-10-16-9-17(12-18)13-19(23)11-16;1-6-2-4-7(5-3-6)11(8,9)10/h15-20H,1-14,24H2;2-5H,1H3,(H,8,9,10) |
| InChIKey | FFSUNHDUVSRYRL-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 128.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.76 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|