About CID 137374744
CID 137374744 (PubChem CID 137374744) has the molecular formula C24H36N2O6
and a molecular weight of 448.56 g/mol.
Molecular Properties
| Compound Name | CID 137374744 |
| PubChem CID | 137374744 |
| Molecular Formula | C24H36N2O6 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.26 |
| IUPAC Name | — |
| SMILES | O=C(O)NC1CCN(C(=O)C[C@@H]2CCC[C@]3(C2)OOC2(O3)C3CC4CC(C3)CC2C4)CC1 |
| InChI | InChI=1S/C24H36N2O6/c27-21(26-6-3-20(4-7-26)25-22(28)29)13-15-2-1-5-23(14-15)30-24(32-31-23)18-9-16-8-17(11-18)12-19(24)10-16/h15-20,25H,1-14H2,(H,28,29)/t15-,16?,17?,18?,19?,23+,24?/m0/s1 |
| InChIKey | HVRYGNAGEROKHH-ZPAAEHINSA-N |
| XLogP | 3.65 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze CID 137374744 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 137374744?
The IUPAC name of CID 137374744 (CID 137374744) is not available.
What is the SMILES notation for CID 137374744?
The canonical SMILES for CID 137374744 is O=C(O)NC1CCN(C(=O)C[C@@H]2CCC[C@]3(C2)OOC2(O3)C3CC4CC(C3)CC2C4)CC1.
What is the InChIKey of CID 137374744?
The InChIKey is HVRYGNAGEROKHH-ZPAAEHINSA-N. The full InChI is InChI=1S/C24H36N2O6/c27-21(26-6-3-20(4-7-26)25-22(28)29)13-15-2-1-5-23(14-15)30-24(32-31-23)18-9-16-8-17(11-18)12-19(24)10-16/h15-20,25H,1-14H2,(H,28,29)/t15-,16?,17?,18?,19?,23+,24?/m0/s1.
What are the key properties of CID 137374744?
CID 137374744 has a molecular weight of 448.56 g/mol, XLogP of 3.65, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 137374744 is sourced from PubChem (CID 137374744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).