C24H36N2O6 — CID 137374744
CID 137374744 (PubChem CID 137374744) has the molecular formula C24H36N2O6 and a molecular weight of 448.56 g/mol.
| Compound Name | CID 137374744 |
|---|---|
| PubChem CID | 137374744 |
| Molecular Formula | C24H36N2O6 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.26 |
| IUPAC Name | — |
| SMILES | O=C(O)NC1CCN(C(=O)C[C@@H]2CCC[C@]3(C2)OOC2(O3)C3CC4CC(C3)CC2C4)CC1 |
| InChI | InChI=1S/C24H36N2O6/c27-21(26-6-3-20(4-7-26)25-22(28)29)13-15-2-1-5-23(14-15)30-24(32-31-23)18-9-16-8-17(11-18)12-19(24)10-16/h15-20,25H,1-14H2,(H,28,29)/t15-,16?,17?,18?,19?,23+,24?/m0/s1 |
| InChIKey | HVRYGNAGEROKHH-ZPAAEHINSA-N |
| XLogP | 3.65 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|