About CID 20801806
CID 20801806 (PubChem CID 20801806) has the molecular formula C19H27NO7
and a molecular weight of 381.43 g/mol.
Molecular Properties
| Compound Name | CID 20801806 |
| PubChem CID | 20801806 |
| Molecular Formula | C19H27NO7 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | — |
| SMILES | O=C(O)COCC(=O)N1CCC2(CC1)OOC1(O2)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C19H27NO7/c21-16(10-24-11-17(22)23)20-3-1-18(2-4-20)25-19(27-26-18)14-6-12-5-13(8-14)9-15(19)7-12/h12-15H,1-11H2,(H,22,23) |
| InChIKey | OUZMUSMYXMYEOS-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze CID 20801806 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 20801806?
The IUPAC name of CID 20801806 (CID 20801806) is not available.
What is the SMILES notation for CID 20801806?
The canonical SMILES for CID 20801806 is O=C(O)COCC(=O)N1CCC2(CC1)OOC1(O2)C2CC3CC(C2)CC1C3.
What is the InChIKey of CID 20801806?
The InChIKey is OUZMUSMYXMYEOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27NO7/c21-16(10-24-11-17(22)23)20-3-1-18(2-4-20)25-19(27-26-18)14-6-12-5-13(8-14)9-15(19)7-12/h12-15H,1-11H2,(H,22,23).
What are the key properties of CID 20801806?
CID 20801806 has a molecular weight of 381.43 g/mol, XLogP of 1.54, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 20801806 is sourced from PubChem (CID 20801806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).