C31H30ClNO — CID 142200028
8-[3-[(3Z)-1-(4-chlorophenyl)-3-ethenylhexa-3,5-dienyl]phenyl]quinoline;methoxymethane (PubChem CID 142200028) has the molecular formula C31H30ClNO and a molecular weight of 468.04 g/mol. Its IUPAC name is 8-[3-[(3Z)-1-(4-chlorophenyl)-3-ethenylhexa-3,5-dienyl]phenyl]quinoline;methoxymethane.
| Compound Name | 8-[3-[(3Z)-1-(4-chlorophenyl)-3-ethenylhexa-3,5-dienyl]phenyl]quinoline;methoxymethane |
|---|---|
| PubChem CID | 142200028 |
| Molecular Formula | C31H30ClNO |
| Molecular Weight | 468.04 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | 8-[3-[(3Z)-1-(4-chlorophenyl)-3-ethenylhexa-3,5-dienyl]phenyl]quinoline;methoxymethane |
| SMILES | C=C/C=C(\C=C)CC(c1ccc(Cl)cc1)c1cccc(-c2cccc3cccnc23)c1.COC |
| InChI | InChI=1S/C29H24ClN.C2H6O/c1-3-8-21(4-2)19-28(22-14-16-26(30)17-15-22)25-11-5-10-24(20-25)27-13-6-9-23-12-7-18-31-29(23)27;1-3-2/h3-18,20,28H,1-2,19H2;1-2H3/b21-8+; |
| InChIKey | CUNJPZXHZNLHPV-LQGGPMKRSA-N |
| XLogP | 8.64 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.04 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|