About propan-1-ol;1-(2-pyridin-2-yl-3-pyridinyl)ethanone
propan-1-ol;1-(2-pyridin-2-yl-3-pyridinyl)ethanone (PubChem CID 142200499) has the molecular formula C15H18N2O2
and a molecular weight of 258.32 g/mol. Its IUPAC name is propan-1-ol;1-(2-pyridin-2-yl-3-pyridinyl)ethanone.
Molecular Properties
| Compound Name | propan-1-ol;1-(2-pyridin-2-yl-3-pyridinyl)ethanone |
| PubChem CID | 142200499 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | propan-1-ol;1-(2-pyridin-2-yl-3-pyridinyl)ethanone |
| SMILES | CC(=O)c1cccnc1-c1ccccn1.CCCO |
| InChI | InChI=1S/C12H10N2O.C3H8O/c1-9(15)10-5-4-8-14-12(10)11-6-2-3-7-13-11;1-2-3-4/h2-8H,1H3;4H,2-3H2,1H3 |
| InChIKey | PZMPEUWTKLOJTH-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze propan-1-ol;1-(2-pyridin-2-yl-3-pyridinyl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-1-ol;1-(2-pyridin-2-yl-3-pyridinyl)ethanone?
The IUPAC name of propan-1-ol;1-(2-pyridin-2-yl-3-pyridinyl)ethanone (CID 142200499) is propan-1-ol;1-(2-pyridin-2-yl-3-pyridinyl)ethanone.
What is the SMILES notation for propan-1-ol;1-(2-pyridin-2-yl-3-pyridinyl)ethanone?
The canonical SMILES for propan-1-ol;1-(2-pyridin-2-yl-3-pyridinyl)ethanone is CC(=O)c1cccnc1-c1ccccn1.CCCO.
What is the InChIKey of propan-1-ol;1-(2-pyridin-2-yl-3-pyridinyl)ethanone?
The InChIKey is PZMPEUWTKLOJTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2O.C3H8O/c1-9(15)10-5-4-8-14-12(10)11-6-2-3-7-13-11;1-2-3-4/h2-8H,1H3;4H,2-3H2,1H3.
What are the key properties of propan-1-ol;1-(2-pyridin-2-yl-3-pyridinyl)ethanone?
propan-1-ol;1-(2-pyridin-2-yl-3-pyridinyl)ethanone has a molecular weight of 258.32 g/mol, XLogP of 2.73, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propan-1-ol;1-(2-pyridin-2-yl-3-pyridinyl)ethanone is sourced from PubChem (CID 142200499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).