C19H20N4O4 — CID 142201001
1-(3,4-dihydroxyphenyl)-3-[3-(4,4-dimethyl-6-oxo-1,5-dihydropyridazin-3-yl)phenyl]urea (PubChem CID 142201001) has the molecular formula C19H20N4O4 and a molecular weight of 368.39 g/mol. Its IUPAC name is 1-(3,4-dihydroxyphenyl)-3-[3-(4,4-dimethyl-6-oxo-1,5-dihydropyridazin-3-yl)phenyl]urea.
| Compound Name | 1-(3,4-dihydroxyphenyl)-3-[3-(4,4-dimethyl-6-oxo-1,5-dihydropyridazin-3-yl)phenyl]urea |
|---|---|
| PubChem CID | 142201001 |
| Molecular Formula | C19H20N4O4 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 1-(3,4-dihydroxyphenyl)-3-[3-(4,4-dimethyl-6-oxo-1,5-dihydropyridazin-3-yl)phenyl]urea |
| SMILES | CC1(C)CC(=O)NN=C1c1cccc(NC(=O)Nc2ccc(O)c(O)c2)c1 |
| InChI | InChI=1S/C19H20N4O4/c1-19(2)10-16(26)22-23-17(19)11-4-3-5-12(8-11)20-18(27)21-13-6-7-14(24)15(25)9-13/h3-9,24-25H,10H2,1-2H3,(H,22,26)(H2,20,21,27) |
| InChIKey | IMYZUPOHBHGEMY-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 123.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|