C15H14N4O3 — CID 165014857
1-(3,4-dihydroxyphenyl)-3-(2-methylidene-1,3-dihydrobenzimidazol-5-yl)urea (PubChem CID 165014857) has the molecular formula C15H14N4O3 and a molecular weight of 298.30 g/mol. Its IUPAC name is 1-(3,4-dihydroxyphenyl)-3-(2-methylidene-1,3-dihydrobenzimidazol-5-yl)urea.
| Compound Name | 1-(3,4-dihydroxyphenyl)-3-(2-methylidene-1,3-dihydrobenzimidazol-5-yl)urea |
|---|---|
| PubChem CID | 165014857 |
| Molecular Formula | C15H14N4O3 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 1-(3,4-dihydroxyphenyl)-3-(2-methylidene-1,3-dihydrobenzimidazol-5-yl)urea |
| SMILES | C=C1Nc2ccc(NC(=O)Nc3ccc(O)c(O)c3)cc2N1 |
| InChI | InChI=1S/C15H14N4O3/c1-8-16-11-4-2-9(6-12(11)17-8)18-15(22)19-10-3-5-13(20)14(21)7-10/h2-7,16-17,20-21H,1H2,(H2,18,19,22) |
| InChIKey | CUDRUWCUCHWBGV-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 105.65 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|