C9H12N4O3 — CID 20543711
1-(3,4-dihydroxyphenyl)-3-(N'-methylcarbamimidoyl)urea (PubChem CID 20543711) has the molecular formula C9H12N4O3 and a molecular weight of 224.22 g/mol. Its IUPAC name is 1-(3,4-dihydroxyphenyl)-3-(N'-methylcarbamimidoyl)urea.
| Compound Name | 1-(3,4-dihydroxyphenyl)-3-(N'-methylcarbamimidoyl)urea |
|---|---|
| PubChem CID | 20543711 |
| Molecular Formula | C9H12N4O3 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 1-(3,4-dihydroxyphenyl)-3-(N'-methylcarbamimidoyl)urea |
| SMILES | C/N=C(\N)NC(=O)Nc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C9H12N4O3/c1-11-8(10)13-9(16)12-5-2-3-6(14)7(15)4-5/h2-4,14-15H,1H3,(H4,10,11,12,13,16) |
| InChIKey | ILORDEJKYUFGHM-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 119.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|