C13H15NO2 — CID 142201396
[2-(2-methoxyphenyl)-1,2-dihydropyridin-4-yl]methanol (PubChem CID 142201396) has the molecular formula C13H15NO2 and a molecular weight of 217.27 g/mol. Its IUPAC name is [2-(2-methoxyphenyl)-1,2-dihydropyridin-4-yl]methanol.
| Compound Name | [2-(2-methoxyphenyl)-1,2-dihydropyridin-4-yl]methanol |
|---|---|
| PubChem CID | 142201396 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | [2-(2-methoxyphenyl)-1,2-dihydropyridin-4-yl]methanol |
| SMILES | COc1ccccc1C1C=C(CO)C=CN1 |
| InChI | InChI=1S/C13H15NO2/c1-16-13-5-3-2-4-11(13)12-8-10(9-15)6-7-14-12/h2-8,12,14-15H,9H2,1H3 |
| InChIKey | SBSVHNHQBXJNTE-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |