C10H10BrNO2 — CID 91532292
3-bromo-5-(2-methoxyphenyl)-2,5-dihydro-1,2-oxazole (PubChem CID 91532292) has the molecular formula C10H10BrNO2 and a molecular weight of 256.10 g/mol. Its IUPAC name is 3-bromo-5-(2-methoxyphenyl)-2,5-dihydro-1,2-oxazole.
| Compound Name | 3-bromo-5-(2-methoxyphenyl)-2,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 91532292 |
| Molecular Formula | C10H10BrNO2 |
| Molecular Weight | 256.10 g/mol |
| Exact Mass | 254.99 |
| IUPAC Name | 3-bromo-5-(2-methoxyphenyl)-2,5-dihydro-1,2-oxazole |
| SMILES | COc1ccccc1C1C=C(Br)NO1 |
| InChI | InChI=1S/C10H10BrNO2/c1-13-8-5-3-2-4-7(8)9-6-10(11)12-14-9/h2-6,9,12H,1H3 |
| InChIKey | VVFFRAFPDBJHAK-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.10 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|