C12H16N2O — CID 20546355
5-(2-methoxyphenyl)-1-methyl-5,6-dihydro-4H-pyrimidine (PubChem CID 20546355) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is 5-(2-methoxyphenyl)-1-methyl-5,6-dihydro-4H-pyrimidine.
| Compound Name | 5-(2-methoxyphenyl)-1-methyl-5,6-dihydro-4H-pyrimidine |
|---|---|
| PubChem CID | 20546355 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 5-(2-methoxyphenyl)-1-methyl-5,6-dihydro-4H-pyrimidine |
| SMILES | COc1ccccc1C1CN=CN(C)C1 |
| InChI | InChI=1S/C12H16N2O/c1-14-8-10(7-13-9-14)11-5-3-4-6-12(11)15-2/h3-6,9-10H,7-8H2,1-2H3 |
| InChIKey | YTYUWESECHCRQX-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |