C13H18N2O — CID 20546333
5-(2-ethoxyphenyl)-1-methyl-5,6-dihydro-4H-pyrimidine (PubChem CID 20546333) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 5-(2-ethoxyphenyl)-1-methyl-5,6-dihydro-4H-pyrimidine.
| Compound Name | 5-(2-ethoxyphenyl)-1-methyl-5,6-dihydro-4H-pyrimidine |
|---|---|
| PubChem CID | 20546333 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 5-(2-ethoxyphenyl)-1-methyl-5,6-dihydro-4H-pyrimidine |
| SMILES | CCOc1ccccc1C1CN=CN(C)C1 |
| InChI | InChI=1S/C13H18N2O/c1-3-16-13-7-5-4-6-12(13)11-8-14-10-15(2)9-11/h4-7,10-11H,3,8-9H2,1-2H3 |
| InChIKey | KZKMMTKJGHVOKY-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |