C11H11BrN2O — CID 141328863
5-bromo-4-(2-methoxyphenyl)-1,4-dihydropyrimidine (PubChem CID 141328863) has the molecular formula C11H11BrN2O and a molecular weight of 267.13 g/mol. Its IUPAC name is 5-bromo-4-(2-methoxyphenyl)-1,4-dihydropyrimidine.
| Compound Name | 5-bromo-4-(2-methoxyphenyl)-1,4-dihydropyrimidine |
|---|---|
| PubChem CID | 141328863 |
| Molecular Formula | C11H11BrN2O |
| Molecular Weight | 267.13 g/mol |
| Exact Mass | 266.01 |
| IUPAC Name | 5-bromo-4-(2-methoxyphenyl)-1,4-dihydropyrimidine |
| SMILES | COc1ccccc1C1N=CNC=C1Br |
| InChI | InChI=1S/C11H11BrN2O/c1-15-10-5-3-2-4-8(10)11-9(12)6-13-7-14-11/h2-7,11H,1H3,(H,13,14) |
| InChIKey | HDKXWIWCALNPTQ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.13 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |