C23H27N7O — CID 142202150
ethane;4-N-methyl-6-[(3-phenylmethoxyanilino)methyl]pteridine-2,4-diamine (PubChem CID 142202150) has the molecular formula C23H27N7O and a molecular weight of 417.52 g/mol. Its IUPAC name is ethane;4-N-methyl-6-[(3-phenylmethoxyanilino)methyl]pteridine-2,4-diamine.
| Compound Name | ethane;4-N-methyl-6-[(3-phenylmethoxyanilino)methyl]pteridine-2,4-diamine |
|---|---|
| PubChem CID | 142202150 |
| Molecular Formula | C23H27N7O |
| Molecular Weight | 417.52 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | ethane;4-N-methyl-6-[(3-phenylmethoxyanilino)methyl]pteridine-2,4-diamine |
| SMILES | CC.CNc1nc(N)nc2ncc(CNc3cccc(OCc4ccccc4)c3)nc12 |
| InChI | InChI=1S/C21H21N7O.C2H6/c1-23-19-18-20(28-21(22)27-19)25-12-16(26-18)11-24-15-8-5-9-17(10-15)29-13-14-6-3-2-4-7-14;1-2/h2-10,12,24H,11,13H2,1H3,(H3,22,23,25,27,28);1-2H3 |
| InChIKey | MZJSQQLWCXFHLW-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 110.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.52 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |