C21H21N7O — CID 142202151
4-N-methyl-6-[(3-phenylmethoxyanilino)methyl]pteridine-2,4-diamine (PubChem CID 142202151) has the molecular formula C21H21N7O and a molecular weight of 387.45 g/mol. Its IUPAC name is 4-N-methyl-6-[(3-phenylmethoxyanilino)methyl]pteridine-2,4-diamine.
| Compound Name | 4-N-methyl-6-[(3-phenylmethoxyanilino)methyl]pteridine-2,4-diamine |
|---|---|
| PubChem CID | 142202151 |
| Molecular Formula | C21H21N7O |
| Molecular Weight | 387.45 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 4-N-methyl-6-[(3-phenylmethoxyanilino)methyl]pteridine-2,4-diamine |
| SMILES | CNc1nc(N)nc2ncc(CNc3cccc(OCc4ccccc4)c3)nc12 |
| InChI | InChI=1S/C21H21N7O/c1-23-19-18-20(28-21(22)27-19)25-12-16(26-18)11-24-15-8-5-9-17(10-15)29-13-14-6-3-2-4-7-14/h2-10,12,24H,11,13H2,1H3,(H3,22,23,25,27,28) |
| InChIKey | YOTUNWMCOYQLKJ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 110.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.45 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |