C21H22FNO5 — CID 142204466
2-[[6-fluoro-1-methoxy-4-(3-methoxyphenyl)cyclohexa-2,4-dien-1-yl]carbamoyl]cyclopentene-1-carboxylic acid (PubChem CID 142204466) has the molecular formula C21H22FNO5 and a molecular weight of 387.41 g/mol. Its IUPAC name is 2-[[6-fluoro-1-methoxy-4-(3-methoxyphenyl)cyclohexa-2,4-dien-1-yl]carbamoyl]cyclopentene-1-carboxylic acid.
| Compound Name | 2-[[6-fluoro-1-methoxy-4-(3-methoxyphenyl)cyclohexa-2,4-dien-1-yl]carbamoyl]cyclopentene-1-carboxylic acid |
|---|---|
| PubChem CID | 142204466 |
| Molecular Formula | C21H22FNO5 |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 2-[[6-fluoro-1-methoxy-4-(3-methoxyphenyl)cyclohexa-2,4-dien-1-yl]carbamoyl]cyclopentene-1-carboxylic acid |
| SMILES | COc1cccc(C2=CC(F)C(NC(=O)C3=C(C(=O)O)CCC3)(OC)C=C2)c1 |
| InChI | InChI=1S/C21H22FNO5/c1-27-15-6-3-5-13(11-15)14-9-10-21(28-2,18(22)12-14)23-19(24)16-7-4-8-17(16)20(25)26/h3,5-6,9-12,18H,4,7-8H2,1-2H3,(H,23,24)(H,25,26) |
| InChIKey | NLQGCLHPUYSMSY-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|