C21H19F2NO4 — CID 171736182
2-[[2,6-difluoro-4-[3-(1,1,2,2,2-pentadeuterioethoxy)phenyl]phenyl]carbamoyl]cyclopentene-1-carboxylic acid (PubChem CID 171736182) has the molecular formula C21H19F2NO4 and a molecular weight of 392.41 g/mol. Its IUPAC name is 2-[[2,6-difluoro-4-[3-(1,1,2,2,2-pentadeuterioethoxy)phenyl]phenyl]carbamoyl]cyclopentene-1-carboxylic acid.
| Compound Name | 2-[[2,6-difluoro-4-[3-(1,1,2,2,2-pentadeuterioethoxy)phenyl]phenyl]carbamoyl]cyclopentene-1-carboxylic acid |
|---|---|
| PubChem CID | 171736182 |
| Molecular Formula | C21H19F2NO4 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 2-[[2,6-difluoro-4-[3-(1,1,2,2,2-pentadeuterioethoxy)phenyl]phenyl]carbamoyl]cyclopentene-1-carboxylic acid |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])Oc1cccc(-c2cc(F)c(NC(=O)C3=C(C(=O)O)CCC3)c(F)c2)c1 |
| InChI | InChI=1S/C21H19F2NO4/c1-2-28-14-6-3-5-12(9-14)13-10-17(22)19(18(23)11-13)24-20(25)15-7-4-8-16(15)21(26)27/h3,5-6,9-11H,2,4,7-8H2,1H3,(H,24,25)(H,26,27)/i1D3,2D2 |
| InChIKey | KOEKNDUNWSNVCY-ZBJDZAJPSA-N |
| XLogP | 4.53 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |