C21H17F2N3O3 — CID 176646698
2-N-[2,6-difluoro-4-[3-(trideuteriomethoxy)phenyl]phenyl]-1-N-isocyanocyclopentene-1,2-dicarboxamide (PubChem CID 176646698) has the molecular formula C21H17F2N3O3 and a molecular weight of 400.40 g/mol. Its IUPAC name is 2-N-[2,6-difluoro-4-[3-(trideuteriomethoxy)phenyl]phenyl]-1-N-isocyanocyclopentene-1,2-dicarboxamide.
| Compound Name | 2-N-[2,6-difluoro-4-[3-(trideuteriomethoxy)phenyl]phenyl]-1-N-isocyanocyclopentene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 176646698 |
| Molecular Formula | C21H17F2N3O3 |
| Molecular Weight | 400.40 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 2-N-[2,6-difluoro-4-[3-(trideuteriomethoxy)phenyl]phenyl]-1-N-isocyanocyclopentene-1,2-dicarboxamide |
| SMILES | [2H]C([2H])([2H])Oc1cccc(-c2cc(F)c(NC(=O)C3=C(C(=O)N[N+]#[C-])CCC3)c(F)c2)c1 |
| InChI | InChI=1S/C21H17F2N3O3/c1-24-26-21(28)16-8-4-7-15(16)20(27)25-19-17(22)10-13(11-18(19)23)12-5-3-6-14(9-12)29-2/h3,5-6,9-11H,4,7-8H2,2H3,(H,25,27)(H,26,28)/i2D3 |
| InChIKey | JKJSBKXSZMNILX-BMSJAHLVSA-N |
| XLogP | 4.01 |
| TPSA | 71.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.40 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|