C20H20FNO3 — CID 175972946
3,3,4,4,5,5-hexadeuterio-2-[[2-fluoro-4-[3-(trideuteriomethoxy)phenyl]anilino]methyl]cyclopentene-1-carboxylic acid (PubChem CID 175972946) has the molecular formula C20H20FNO3 and a molecular weight of 350.44 g/mol. Its IUPAC name is 3,3,4,4,5,5-hexadeuterio-2-[[2-fluoro-4-[3-(trideuteriomethoxy)phenyl]anilino]methyl]cyclopentene-1-carboxylic acid.
| Compound Name | 3,3,4,4,5,5-hexadeuterio-2-[[2-fluoro-4-[3-(trideuteriomethoxy)phenyl]anilino]methyl]cyclopentene-1-carboxylic acid |
|---|---|
| PubChem CID | 175972946 |
| Molecular Formula | C20H20FNO3 |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 3,3,4,4,5,5-hexadeuterio-2-[[2-fluoro-4-[3-(trideuteriomethoxy)phenyl]anilino]methyl]cyclopentene-1-carboxylic acid |
| SMILES | [2H]C([2H])([2H])Oc1cccc(-c2ccc(NCC3=C(C(=O)O)C([2H])([2H])C([2H])([2H])C3([2H])[2H])c(F)c2)c1 |
| InChI | InChI=1S/C20H20FNO3/c1-25-16-6-2-4-13(10-16)14-8-9-19(18(21)11-14)22-12-15-5-3-7-17(15)20(23)24/h2,4,6,8-11,22H,3,5,7,12H2,1H3,(H,23,24)/i1D3,3D2,5D2,7D2 |
| InChIKey | CMHCHSJOFYBGQC-NPNXCVMYSA-N |
| XLogP | 4.48 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |