C20H19F2N3O3 — CID 175921146
3-[2,6-difluoro-4-[3-(trideuteriomethoxy)phenyl]phenyl]-2-(N'-hydroxycarbamimidoyl)cyclopentene-1-carboxamide (PubChem CID 175921146) has the molecular formula C20H19F2N3O3 and a molecular weight of 390.40 g/mol. Its IUPAC name is 3-[2,6-difluoro-4-[3-(trideuteriomethoxy)phenyl]phenyl]-2-(N'-hydroxycarbamimidoyl)cyclopentene-1-carboxamide.
| Compound Name | 3-[2,6-difluoro-4-[3-(trideuteriomethoxy)phenyl]phenyl]-2-(N'-hydroxycarbamimidoyl)cyclopentene-1-carboxamide |
|---|---|
| PubChem CID | 175921146 |
| Molecular Formula | C20H19F2N3O3 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 3-[2,6-difluoro-4-[3-(trideuteriomethoxy)phenyl]phenyl]-2-(N'-hydroxycarbamimidoyl)cyclopentene-1-carboxamide |
| SMILES | [2H]C([2H])([2H])Oc1cccc(-c2cc(F)c(C3CCC(C(N)=O)=C3C(N)=NO)c(F)c2)c1 |
| InChI | InChI=1S/C20H19F2N3O3/c1-28-12-4-2-3-10(7-12)11-8-15(21)18(16(22)9-11)13-5-6-14(20(24)26)17(13)19(23)25-27/h2-4,7-9,13,27H,5-6H2,1H3,(H2,23,25)(H2,24,26)/i1D3 |
| InChIKey | VYPMLZZOIGXYDW-FIBGUPNXSA-N |
| XLogP | 3.05 |
| TPSA | 110.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|