C25H21F2NO4 — CID 58503578
[2-[[4-(3-cyclopentyloxyphenyl)-2,6-difluorophenyl]carbamoyl]phenyl] formate (PubChem CID 58503578) has the molecular formula C25H21F2NO4 and a molecular weight of 437.44 g/mol. Its IUPAC name is [2-[[4-(3-cyclopentyloxyphenyl)-2,6-difluorophenyl]carbamoyl]phenyl] formate.
| Compound Name | [2-[[4-(3-cyclopentyloxyphenyl)-2,6-difluorophenyl]carbamoyl]phenyl] formate |
|---|---|
| PubChem CID | 58503578 |
| Molecular Formula | C25H21F2NO4 |
| Molecular Weight | 437.44 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | [2-[[4-(3-cyclopentyloxyphenyl)-2,6-difluorophenyl]carbamoyl]phenyl] formate |
| SMILES | O=COc1ccccc1C(=O)Nc1c(F)cc(-c2cccc(OC3CCCC3)c2)cc1F |
| InChI | InChI=1S/C25H21F2NO4/c26-21-13-17(16-6-5-9-19(12-16)32-18-7-1-2-8-18)14-22(27)24(21)28-25(30)20-10-3-4-11-23(20)31-15-29/h3-6,9-15,18H,1-2,7-8H2,(H,28,30) |
| InChIKey | YJRCHSIWFXNYBF-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.44 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|