C22H15ClFNO4 — CID 58503586
[2-[[2-chloro-4-(2,3-dihydro-1-benzofuran-5-yl)-6-fluorophenyl]carbamoyl]phenyl] formate (PubChem CID 58503586) has the molecular formula C22H15ClFNO4 and a molecular weight of 411.82 g/mol. Its IUPAC name is [2-[[2-chloro-4-(2,3-dihydro-1-benzofuran-5-yl)-6-fluorophenyl]carbamoyl]phenyl] formate.
| Compound Name | [2-[[2-chloro-4-(2,3-dihydro-1-benzofuran-5-yl)-6-fluorophenyl]carbamoyl]phenyl] formate |
|---|---|
| PubChem CID | 58503586 |
| Molecular Formula | C22H15ClFNO4 |
| Molecular Weight | 411.82 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | [2-[[2-chloro-4-(2,3-dihydro-1-benzofuran-5-yl)-6-fluorophenyl]carbamoyl]phenyl] formate |
| SMILES | O=COc1ccccc1C(=O)Nc1c(F)cc(-c2ccc3c(c2)CCO3)cc1Cl |
| InChI | InChI=1S/C22H15ClFNO4/c23-17-10-15(13-5-6-19-14(9-13)7-8-28-19)11-18(24)21(17)25-22(27)16-3-1-2-4-20(16)29-12-26/h1-6,9-12H,7-8H2,(H,25,27) |
| InChIKey | CRGFJKHHRZJIBR-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.82 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|