C31H45N3O3 — CID 142204937
2-[1-[8-[4-[(Z,2E)-2-ethylidenepent-3-enoxy]phenoxy]octoxy]-3-phenylpropan-2-yl]guanidine (PubChem CID 142204937) has the molecular formula C31H45N3O3 and a molecular weight of 507.72 g/mol. Its IUPAC name is 2-[1-[8-[4-[(Z,2E)-2-ethylidenepent-3-enoxy]phenoxy]octoxy]-3-phenylpropan-2-yl]guanidine.
| Compound Name | 2-[1-[8-[4-[(Z,2E)-2-ethylidenepent-3-enoxy]phenoxy]octoxy]-3-phenylpropan-2-yl]guanidine |
|---|---|
| PubChem CID | 142204937 |
| Molecular Formula | C31H45N3O3 |
| Molecular Weight | 507.72 g/mol |
| Exact Mass | 507.35 |
| IUPAC Name | 2-[1-[8-[4-[(Z,2E)-2-ethylidenepent-3-enoxy]phenoxy]octoxy]-3-phenylpropan-2-yl]guanidine |
| SMILES | C/C=C\C(=C/C)COc1ccc(OCCCCCCCCOCC(Cc2ccccc2)N=C(N)N)cc1 |
| InChI | InChI=1S/C31H45N3O3/c1-3-14-26(4-2)24-37-30-19-17-29(18-20-30)36-22-13-8-6-5-7-12-21-35-25-28(34-31(32)33)23-27-15-10-9-11-16-27/h3-4,9-11,14-20,28H,5-8,12-13,21-25H2,1-2H3,(H4,32,33,34)/b14-3-,26-4+ |
| InChIKey | LLGUXBBDRWPMOZ-BTWBNVMCSA-N |
| XLogP | 6.21 |
| TPSA | 92.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.72 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|